C31H42N2O12 — CID 68938067
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-(3-hydroxypropoxy)-2-methylphenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 68938067) has the molecular formula C31H42N2O12 and a molecular weight of 634.68 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-(3-hydroxypropoxy)-2-methylphenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-(3-hydroxypropoxy)-2-methylphenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68938067 |
| Molecular Formula | C31H42N2O12 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-(3-hydroxypropoxy)-2-methylphenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2n[nH]c(C(C)C)c2Cc2ccc(OCCCO)cc2C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H42N2O12/c1-16(2)26-24(14-22-9-10-23(13-17(22)3)39-12-8-11-34)30(33-32-26)45-31-29(43-21(7)38)28(42-20(6)37)27(41-19(5)36)25(44-31)15-40-18(4)35/h9-10,13,16,25,27-29,31,34H,8,11-12,14-15H2,1-7H3,(H,32,33)/t25-,27+,28+,29-,31+/m1/s1 |
| InChIKey | LEIXQUMIVDQJHX-AUNDWGALSA-N |
| XLogP | 2.66 |
| TPSA | 181.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|