C32H44N4O12 — CID 68940048
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-[2-[(2-amino-2-oxoethyl)amino]ethoxy]-2-methylphenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 68940048) has the molecular formula C32H44N4O12 and a molecular weight of 676.72 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-[2-[(2-amino-2-oxoethyl)amino]ethoxy]-2-methylphenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-[2-[(2-amino-2-oxoethyl)amino]ethoxy]-2-methylphenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68940048 |
| Molecular Formula | C32H44N4O12 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[[4-[2-[(2-amino-2-oxoethyl)amino]ethoxy]-2-methylphenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2n[nH]c(C(C)C)c2Cc2ccc(OCCNCC(N)=O)cc2C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H44N4O12/c1-16(2)27-24(13-22-8-9-23(12-17(22)3)42-11-10-34-14-26(33)41)31(36-35-27)48-32-30(46-21(7)40)29(45-20(6)39)28(44-19(5)38)25(47-32)15-43-18(4)37/h8-9,12,16,25,28-30,32,34H,10-11,13-15H2,1-7H3,(H2,33,41)(H,35,36)/t25-,28-,29+,30-,32+/m1/s1 |
| InChIKey | YWHSXVOBXACCAR-NTWRQFCJSA-N |
| XLogP | 1.35 |
| TPSA | 216.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|