C36H44N2O11 — CID 90919867
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[[2-[(2,5-dimethylphenyl)methoxy]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 90919867) has the molecular formula C36H44N2O11 and a molecular weight of 680.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[[2-[(2,5-dimethylphenyl)methoxy]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[[2-[(2,5-dimethylphenyl)methoxy]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90919867 |
| Molecular Formula | C36H44N2O11 |
| Molecular Weight | 680.75 g/mol |
| Exact Mass | 680.29 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[[2-[(2,5-dimethylphenyl)methoxy]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Oc2n[nH]c(C(C)C)c2Cc2ccccc2OCc2cc(C)ccc2C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C36H44N2O11/c1-19(2)31-28(16-26-11-9-10-12-29(26)44-17-27-15-20(3)13-14-21(27)4)35(38-37-31)49-36-34(47-25(8)42)33(46-24(7)41)32(45-23(6)40)30(48-36)18-43-22(5)39/h9-15,19,30,32-34,36H,16-18H2,1-8H3,(H,37,38)/t30-,32-,33+,34-,36?/m1/s1 |
| InChIKey | GVAIQNYXUXPSRF-AOOQTOLUSA-N |
| XLogP | 4.78 |
| TPSA | 161.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|