C33H33F5N2O11 — CID 91553875
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[5-(1,1,2,2,2-pentafluoroethyl)-4-[(2-phenylmethoxyphenyl)methyl]-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 91553875) has the molecular formula C33H33F5N2O11 and a molecular weight of 728.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[5-(1,1,2,2,2-pentafluoroethyl)-4-[(2-phenylmethoxyphenyl)methyl]-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[5-(1,1,2,2,2-pentafluoroethyl)-4-[(2-phenylmethoxyphenyl)methyl]-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91553875 |
| Molecular Formula | C33H33F5N2O11 |
| Molecular Weight | 728.62 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[5-(1,1,2,2,2-pentafluoroethyl)-4-[(2-phenylmethoxyphenyl)methyl]-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Oc2n[nH]c(C(F)(F)C(F)(F)F)c2Cc2ccccc2OCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H33F5N2O11/c1-17(41)45-16-25-26(47-18(2)42)27(48-19(3)43)28(49-20(4)44)31(50-25)51-30-23(29(39-40-30)32(34,35)33(36,37)38)14-22-12-8-9-13-24(22)46-15-21-10-6-5-7-11-21/h5-13,25-28,31H,14-16H2,1-4H3,(H,39,40)/t25-,26-,27+,28-,31?/m1/s1 |
| InChIKey | SHGDWBHMBBQCFJ-MIZCYEMTSA-N |
| XLogP | 4.70 |
| TPSA | 161.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|