C29H31BrO12 — CID 10818022
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(2-bromoacetyl)-3-phenylmethoxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 10818022) has the molecular formula C29H31BrO12 and a molecular weight of 651.46 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(2-bromoacetyl)-3-phenylmethoxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(2-bromoacetyl)-3-phenylmethoxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10818022 |
| Molecular Formula | C29H31BrO12 |
| Molecular Weight | 651.46 g/mol |
| Exact Mass | 650.10 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(2-bromoacetyl)-3-phenylmethoxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cccc(OCc3ccccc3)c2C(=O)CBr)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H31BrO12/c1-16(31)36-15-24-26(38-17(2)32)27(39-18(3)33)28(40-19(4)34)29(42-24)41-23-12-8-11-22(25(23)21(35)13-30)37-14-20-9-6-5-7-10-20/h5-12,24,26-29H,13-15H2,1-4H3/t24-,26-,27+,28-,29-/m1/s1 |
| InChIKey | JFIWWMFSGUZBHJ-KRZJEZTLSA-N |
| XLogP | 3.31 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|