C35H39F3N2O11 — CID 90721740
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[[4-(3-phenylmethoxypropyl)phenyl]methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 90721740) has the molecular formula C35H39F3N2O11 and a molecular weight of 720.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[[4-(3-phenylmethoxypropyl)phenyl]methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[[4-(3-phenylmethoxypropyl)phenyl]methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90721740 |
| Molecular Formula | C35H39F3N2O11 |
| Molecular Weight | 720.69 g/mol |
| Exact Mass | 720.25 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[[4-[[4-(3-phenylmethoxypropyl)phenyl]methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Oc2n[nH]c(C(F)(F)F)c2Cc2ccc(CCCOCc3ccccc3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C35H39F3N2O11/c1-20(41)46-19-28-29(47-21(2)42)30(48-22(3)43)31(49-23(4)44)34(50-28)51-33-27(32(39-40-33)35(36,37)38)17-25-14-12-24(13-15-25)11-8-16-45-18-26-9-6-5-7-10-26/h5-7,9-10,12-15,28-31,34H,8,11,16-19H2,1-4H3,(H,39,40)/t28-,29-,30+,31-,34?/m1/s1 |
| InChIKey | UPMMVVICXXMDCQ-GYNNQMKTSA-N |
| XLogP | 4.63 |
| TPSA | 161.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|