C26H29F3N2O11 — CID 68945468
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[(4-hydroxy-2-methylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 68945468) has the molecular formula C26H29F3N2O11 and a molecular weight of 602.52 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[(4-hydroxy-2-methylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[(4-hydroxy-2-methylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68945468 |
| Molecular Formula | C26H29F3N2O11 |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[4-[(4-hydroxy-2-methylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2n[nH]c(C(F)(F)F)c2Cc2ccc(O)cc2C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H29F3N2O11/c1-11-8-17(36)7-6-16(11)9-18-23(26(27,28)29)30-31-24(18)42-25-22(40-15(5)35)21(39-14(4)34)20(38-13(3)33)19(41-25)10-37-12(2)32/h6-8,19-22,25,36H,9-10H2,1-5H3,(H,30,31)/t19-,20+,21+,22-,25+/m1/s1 |
| InChIKey | QUHMRSCOFUFDKB-HNTODFAGSA-N |
| XLogP | 2.50 |
| TPSA | 172.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|