C20H17NO6 — CID 160624467
[(2R,3R)-3-benzoyloxy-5-isocyanatooxolan-2-yl]methyl benzoate (PubChem CID 160624467) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is [(2R,3R)-3-benzoyloxy-5-isocyanatooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R)-3-benzoyloxy-5-isocyanatooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 160624467 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(2R,3R)-3-benzoyloxy-5-isocyanatooxolan-2-yl]methyl benzoate |
| SMILES | O=C=NC1C[C@@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C20H17NO6/c22-13-21-18-11-16(27-20(24)15-9-5-2-6-10-15)17(26-18)12-25-19(23)14-7-3-1-4-8-14/h1-10,16-18H,11-12H2/t16-,17-,18?/m1/s1 |
| InChIKey | NZQRGOOJQPCXRM-OWZOALSMSA-N |
| XLogP | 2.52 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|