C24H34O5Si — CID 144948924
(2R,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2-hydroxypropan-2-yloxy)oxolan-3-ol (PubChem CID 144948924) has the molecular formula C24H34O5Si and a molecular weight of 430.62 g/mol. Its IUPAC name is (2R,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2-hydroxypropan-2-yloxy)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2-hydroxypropan-2-yloxy)oxolan-3-ol |
|---|---|
| PubChem CID | 144948924 |
| Molecular Formula | C24H34O5Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2R,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2-hydroxypropan-2-yloxy)oxolan-3-ol |
| SMILES | CC(C)(O)O[C@@H]1C[C@@H](O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C24H34O5Si/c1-23(2,3)30(18-12-8-6-9-13-18,19-14-10-7-11-15-19)27-17-21-20(25)16-22(28-21)29-24(4,5)26/h6-15,20-22,25-26H,16-17H2,1-5H3/t20-,21-,22-/m1/s1 |
| InChIKey | YNXMPNRXFMERSD-YPAWHYETSA-N |
| XLogP | 2.78 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|