C22H27ClO2Si — CID 11101116
tert-butyl-[[(1R,2S,4R,5S)-4-chloro-3-oxabicyclo[3.1.0]hexan-2-yl]methoxy]-diphenylsilane (PubChem CID 11101116) has the molecular formula C22H27ClO2Si and a molecular weight of 387.00 g/mol. Its IUPAC name is tert-butyl-[[(1R,2S,4R,5S)-4-chloro-3-oxabicyclo[3.1.0]hexan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,2S,4R,5S)-4-chloro-3-oxabicyclo[3.1.0]hexan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11101116 |
| Molecular Formula | C22H27ClO2Si |
| Molecular Weight | 387.00 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | tert-butyl-[[(1R,2S,4R,5S)-4-chloro-3-oxabicyclo[3.1.0]hexan-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](Cl)[C@H]2C[C@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27ClO2Si/c1-22(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)24-15-20-18-14-19(18)21(23)25-20/h4-13,18-21H,14-15H2,1-3H3/t18-,19+,20-,21+/m1/s1 |
| InChIKey | UEGBUCAIYFYYDX-MHTWAQMVSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.00 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|