C24H32O2Si2 — CID 166437595
tert-butyl-diphenyl-[[(2R)-3-(2-trimethylsilylethynyl)oxiran-2-yl]methoxy]silane (PubChem CID 166437595) has the molecular formula C24H32O2Si2 and a molecular weight of 408.69 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2R)-3-(2-trimethylsilylethynyl)oxiran-2-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(2R)-3-(2-trimethylsilylethynyl)oxiran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 166437595 |
| Molecular Formula | C24H32O2Si2 |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | tert-butyl-diphenyl-[[(2R)-3-(2-trimethylsilylethynyl)oxiran-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC1C#C[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O2Si2/c1-24(2,3)28(20-13-9-7-10-14-20,21-15-11-8-12-16-21)25-19-23-22(26-23)17-18-27(4,5)6/h7-16,22-23H,19H2,1-6H3/t22?,23-/m1/s1 |
| InChIKey | RXVQENRKIJVYPJ-OZAIVSQSSA-N |
| XLogP | 4.21 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|