C27H36O3Si — CID 101378354
tert-butyl-[[(4R,5S)-2,2-dimethyl-5-pent-1-ynyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane (PubChem CID 101378354) has the molecular formula C27H36O3Si and a molecular weight of 436.67 g/mol. Its IUPAC name is tert-butyl-[[(4R,5S)-2,2-dimethyl-5-pent-1-ynyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(4R,5S)-2,2-dimethyl-5-pent-1-ynyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101378354 |
| Molecular Formula | C27H36O3Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | tert-butyl-[[(4R,5S)-2,2-dimethyl-5-pent-1-ynyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane |
| SMILES | CCCC#C[C@@H]1OC(C)(C)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H36O3Si/c1-7-8-11-20-24-25(30-27(5,6)29-24)21-28-31(26(2,3)4,22-16-12-9-13-17-22)23-18-14-10-15-19-23/h9-10,12-19,24-25H,7-8,21H2,1-6H3/t24-,25+/m0/s1 |
| InChIKey | JRPNIDPUVNMPEY-LOSJGSFVSA-N |
| XLogP | 4.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|