C26H36O4Si — CID 135012265
[(3aR,6R,6aR)-2,2,4,4-tetramethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 135012265) has the molecular formula C26H36O4Si and a molecular weight of 440.66 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2,4,4-tetramethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,6R,6aR)-2,2,4,4-tetramethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 135012265 |
| Molecular Formula | C26H36O4Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | [(3aR,6R,6aR)-2,2,4,4-tetramethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)C(C)(C)O[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36O4Si/c1-24(2,3)31(19-14-10-8-11-15-19,20-16-12-9-13-17-20)27-18-21-22-23(25(4,5)28-21)30-26(6,7)29-22/h8-17,21-23H,18H2,1-7H3/t21-,22-,23-/m1/s1 |
| InChIKey | PJSVHJAACQMLQL-DNVJHFABSA-N |
| XLogP | 4.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|