C26H36O7SSi — CID 101230365
[(4S,5R)-5-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 101230365) has the molecular formula C26H36O7SSi and a molecular weight of 520.72 g/mol. Its IUPAC name is [(4S,5R)-5-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(4S,5R)-5-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101230365 |
| Molecular Formula | C26H36O7SSi |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [(4S,5R)-5-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CC1(C)O[C@@H]([C@@H]2O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C26H36O7SSi/c1-25(2,3)35(19-13-9-7-10-14-19,20-15-11-8-12-16-20)30-18-21-23(31-21)24-22(17-29-34(6,27)28)32-26(4,5)33-24/h7-16,21-24H,17-18H2,1-6H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | ZURTUUAKUXBHFL-UEQSERJNSA-N |
| XLogP | 2.83 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|