C29H42O8SSi — CID 10325861
[(2R,3R,6S)-2-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methoxyoxan-3-yl] methanesulfonate (PubChem CID 10325861) has the molecular formula C29H42O8SSi and a molecular weight of 578.80 g/mol. Its IUPAC name is [(2R,3R,6S)-2-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methoxyoxan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,6S)-2-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methoxyoxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 10325861 |
| Molecular Formula | C29H42O8SSi |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | [(2R,3R,6S)-2-[(4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methoxyoxan-3-yl] methanesulfonate |
| SMILES | CO[C@@H]1CC[C@@H](OS(C)(=O)=O)[C@@H]([C@@H]2OC(C)(C)O[C@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H42O8SSi/c1-28(2,3)39(21-14-10-8-11-15-21,22-16-12-9-13-17-22)33-20-24-27(36-29(4,5)35-24)26-23(37-38(7,30)31)18-19-25(32-6)34-26/h8-17,23-27H,18-20H2,1-7H3/t23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | RSHMXJFJPPXWGZ-NNRJALBFSA-N |
| XLogP | 3.58 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|