C30H36O5Si — CID 101444428
(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-phenyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol (PubChem CID 101444428) has the molecular formula C30H36O5Si and a molecular weight of 504.70 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-phenyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-phenyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 101444428 |
| Molecular Formula | C30H36O5Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | (3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-phenyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@](O)(c1ccccc1)O[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H36O5Si/c1-28(2,3)36(23-17-11-7-12-18-23,24-19-13-8-14-20-24)32-21-25-26-27(35-29(4,5)34-26)30(31,33-25)22-15-9-6-10-16-22/h6-20,25-27,31H,21H2,1-5H3/t25-,26-,27-,30-/m1/s1 |
| InChIKey | QABTWVULLWYSHH-NSBPXKJOSA-N |
| XLogP | 4.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|