C32H37NO5Si — CID 11307283
(3aR,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1H-indol-2-yl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol (PubChem CID 11307283) has the molecular formula C32H37NO5Si and a molecular weight of 543.74 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1H-indol-2-yl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (3aR,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1H-indol-2-yl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 11307283 |
| Molecular Formula | C32H37NO5Si |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | (3aR,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1H-indol-2-yl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)C(O)(c1cc3ccccc3[nH]1)O[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H37NO5Si/c1-30(2,3)39(23-15-8-6-9-16-23,24-17-10-7-11-18-24)35-21-26-28-29(38-31(4,5)37-28)32(34,36-26)27-20-22-14-12-13-19-25(22)33-27/h6-20,26,28-29,33-34H,21H2,1-5H3/t26-,28-,29-,32?/m1/s1 |
| InChIKey | WAJYKTOMLXCJAS-IBTCCFRKSA-N |
| XLogP | 4.81 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|