C28H38O7Si — CID 122173438
(4S,4aS,8R,8aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6,6-tetramethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylic acid (PubChem CID 122173438) has the molecular formula C28H38O7Si and a molecular weight of 514.69 g/mol. Its IUPAC name is (4S,4aS,8R,8aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6,6-tetramethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylic acid.
| Compound Name | (4S,4aS,8R,8aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6,6-tetramethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylic acid |
|---|---|
| PubChem CID | 122173438 |
| Molecular Formula | C28H38O7Si |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (4S,4aS,8R,8aR)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6,6-tetramethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylic acid |
| SMILES | CC1(C)O[C@H]2[C@H](OC(C)(C)O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C28H38O7Si/c1-26(2,3)36(19-14-10-8-11-15-19,20-16-12-9-13-17-20)31-18-21-22-23(34-27(4,5)32-21)24(25(29)30)35-28(6,7)33-22/h8-17,21-24H,18H2,1-7H3,(H,29,30)/t21-,22-,23+,24+/m1/s1 |
| InChIKey | YXSQFZZPVQGUSH-LWSSLDFYSA-N |
| XLogP | 3.69 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|