C30H37NO7Si — CID 10918669
methoxymethyl (E)-3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-cyanoprop-2-enoate (PubChem CID 10918669) has the molecular formula C30H37NO7Si and a molecular weight of 551.71 g/mol. Its IUPAC name is methoxymethyl (E)-3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-cyanoprop-2-enoate.
| Compound Name | methoxymethyl (E)-3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 10918669 |
| Molecular Formula | C30H37NO7Si |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | methoxymethyl (E)-3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-cyanoprop-2-enoate |
| SMILES | COCOC(=O)/C=C(\C#N)[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C30H37NO7Si/c1-29(2,3)39(22-13-9-7-10-14-22,23-15-11-8-12-16-23)35-19-24-27-28(38-30(4,5)37-27)26(36-24)21(18-31)17-25(32)34-20-33-6/h7-17,24,26-28H,19-20H2,1-6H3/b21-17+/t24-,26+,27-,28+/m1/s1 |
| InChIKey | BIEUODXSIXITTK-AJGYJBRGSA-N |
| XLogP | 3.45 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_E(1)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|