C29H35N3O4Si — CID 66825674
3-amino-4-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-pyrrole-2-carbonitrile (PubChem CID 66825674) has the molecular formula C29H35N3O4Si and a molecular weight of 517.70 g/mol. Its IUPAC name is 3-amino-4-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-pyrrole-2-carbonitrile.
| Compound Name | 3-amino-4-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 66825674 |
| Molecular Formula | C29H35N3O4Si |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 3-amino-4-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-pyrrole-2-carbonitrile |
| SMILES | CC1(C)OC2C(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(c3c[nH]c(C#N)c3N)C2O1 |
| InChI | InChI=1S/C29H35N3O4Si/c1-28(2,3)37(19-12-8-6-9-13-19,20-14-10-7-11-15-20)33-18-23-26-27(36-29(4,5)35-26)25(34-23)21-17-32-22(16-30)24(21)31/h6-15,17,23,25-27,32H,18,31H2,1-5H3 |
| InChIKey | FNJVKMGDQYZHDT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|