C26H36O5SSi — CID 91310522
(3aS,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 91310522) has the molecular formula C26H36O5SSi and a molecular weight of 488.72 g/mol. Its IUPAC name is (3aS,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aS,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 91310522 |
| Molecular Formula | C26H36O5SSi |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (3aS,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CSC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C26H36O5SSi/c1-25(2,3)33(18-13-9-7-10-14-18,19-15-11-8-12-16-19)28-17-20-22-23(31-26(4,5)30-22)21(27)24(29-20)32-6/h7-16,20-24,27H,17H2,1-6H3/t20?,21-,22-,23+,24?/m0/s1 |
| InChIKey | COLUEYDRPNVORA-JBOUMKSFSA-N |
| XLogP | 3.53 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|