C28H34O7Si — CID 11733954
3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-hydroxy-2H-furan-5-one (PubChem CID 11733954) has the molecular formula C28H34O7Si and a molecular weight of 510.66 g/mol. Its IUPAC name is 3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-hydroxy-2H-furan-5-one.
| Compound Name | 3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 11733954 |
| Molecular Formula | C28H34O7Si |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-hydroxy-2H-furan-5-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[C@H]2C1=CC(=O)OC1O |
| InChI | InChI=1S/C28H34O7Si/c1-27(2,3)36(18-12-8-6-9-13-18,19-14-10-7-11-15-19)31-17-21-24-25(35-28(4,5)34-24)23(32-21)20-16-22(29)33-26(20)30/h6-16,21,23-26,30H,17H2,1-5H3/t21-,23+,24-,25+,26?/m1/s1 |
| InChIKey | WZDGLIYHOGNBJY-KHMUOAIPSA-N |
| XLogP | 2.65 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|