C30H42O7SSi — CID 100939307
methyl 4-[[(3aS,4R,6S,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]sulfanyl]butanoate (PubChem CID 100939307) has the molecular formula C30H42O7SSi and a molecular weight of 574.81 g/mol. Its IUPAC name is methyl 4-[[(3aS,4R,6S,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]sulfanyl]butanoate.
| Compound Name | methyl 4-[[(3aS,4R,6S,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 100939307 |
| Molecular Formula | C30H42O7SSi |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | methyl 4-[[(3aS,4R,6S,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]sulfanyl]butanoate |
| SMILES | COC(=O)CCCS[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C30H42O7SSi/c1-29(2,3)39(21-14-9-7-10-15-21,22-16-11-8-12-17-22)34-20-23-26-27(37-30(4,5)36-26)25(32)28(35-23)38-19-13-18-24(31)33-6/h7-12,14-17,23,25-28,32H,13,18-20H2,1-6H3/t23-,25-,26+,27-,28+/m1/s1 |
| InChIKey | MUINTTPKYASCMC-IPTPSVHJSA-N |
| XLogP | 3.86 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|