C27H38O7SSi — CID 20739089
methyl 4-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylbutanoate (PubChem CID 20739089) has the molecular formula C27H38O7SSi and a molecular weight of 534.75 g/mol. Its IUPAC name is methyl 4-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylbutanoate.
| Compound Name | methyl 4-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 20739089 |
| Molecular Formula | C27H38O7SSi |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | methyl 4-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylbutanoate |
| SMILES | COC(=O)CCCSC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(O)C(O)C1O |
| InChI | InChI=1S/C27H38O7SSi/c1-27(2,3)36(19-12-7-5-8-13-19,20-14-9-6-10-15-20)33-18-21-23(29)24(30)25(31)26(34-21)35-17-11-16-22(28)32-4/h5-10,12-15,21,23-26,29-31H,11,16-18H2,1-4H3 |
| InChIKey | AAAOYIHNUZCDHF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|