C26H36O5Si — CID 12041081
1-[(2S,3R,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4-dihydroxyoxan-2-yl]propan-2-one (PubChem CID 12041081) has the molecular formula C26H36O5Si and a molecular weight of 456.66 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4-dihydroxyoxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,3R,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4-dihydroxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 12041081 |
| Molecular Formula | C26H36O5Si |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 1-[(2S,3R,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4-dihydroxyoxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1OC[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H36O5Si/c1-19(27)17-23-25(29)24(28)20(18-30-23)15-16-31-32(26(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,20,23-25,28-29H,15-18H2,1-4H3/t20-,23-,24+,25-/m0/s1 |
| InChIKey | ATQNGWNGQPWUQX-OXCBMLQPSA-N |
| XLogP | 2.67 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|