C25H34O3Si — CID 146164183
tert-butyl-[2-[(2R,3S)-3-methoxy-2,3,4,7-tetrahydrooxepin-2-yl]ethoxy]-diphenylsilane (PubChem CID 146164183) has the molecular formula C25H34O3Si and a molecular weight of 410.63 g/mol. Its IUPAC name is tert-butyl-[2-[(2R,3S)-3-methoxy-2,3,4,7-tetrahydrooxepin-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2R,3S)-3-methoxy-2,3,4,7-tetrahydrooxepin-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 146164183 |
| Molecular Formula | C25H34O3Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | tert-butyl-[2-[(2R,3S)-3-methoxy-2,3,4,7-tetrahydrooxepin-2-yl]ethoxy]-diphenylsilane |
| SMILES | CO[C@H]1CC=CCO[C@@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O3Si/c1-25(2,3)29(21-13-7-5-8-14-21,22-15-9-6-10-16-22)28-20-18-24-23(26-4)17-11-12-19-27-24/h5-16,23-24H,17-20H2,1-4H3/t23-,24+/m0/s1 |
| InChIKey | JWZJALCHEOSWSN-BJKOFHAPSA-N |
| XLogP | 4.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|