C30H36O3SSi — CID 24769865
tert-butyl-[2-[(2S,3R)-3-[(R)-(4-methylphenyl)sulfinyl]-3,6-dihydro-2H-pyran-2-yl]ethoxy]-diphenylsilane (PubChem CID 24769865) has the molecular formula C30H36O3SSi and a molecular weight of 504.77 g/mol. Its IUPAC name is tert-butyl-[2-[(2S,3R)-3-[(R)-(4-methylphenyl)sulfinyl]-3,6-dihydro-2H-pyran-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2S,3R)-3-[(R)-(4-methylphenyl)sulfinyl]-3,6-dihydro-2H-pyran-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 24769865 |
| Molecular Formula | C30H36O3SSi |
| Molecular Weight | 504.77 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | tert-butyl-[2-[(2S,3R)-3-[(R)-(4-methylphenyl)sulfinyl]-3,6-dihydro-2H-pyran-2-yl]ethoxy]-diphenylsilane |
| SMILES | Cc1ccc([S@](=O)[C@@H]2C=CCO[C@H]2CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H36O3SSi/c1-24-17-19-25(20-18-24)34(31)29-16-11-22-32-28(29)21-23-33-35(30(2,3)4,26-12-7-5-8-13-26)27-14-9-6-10-15-27/h5-20,28-29H,21-23H2,1-4H3/t28-,29+,34-/m0/s1 |
| InChIKey | JRNWPDVFZVNHND-ZZMKVXQQSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.77 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|