C32H42O6SSi — CID 11039165
[(2R,3S,6R)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11039165) has the molecular formula C32H42O6SSi and a molecular weight of 582.84 g/mol. Its IUPAC name is [(2R,3S,6R)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,6R)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11039165 |
| Molecular Formula | C32H42O6SSi |
| Molecular Weight | 582.84 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | [(2R,3S,6R)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@H](CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@@H]2O)cc1 |
| InChI | InChI=1S/C32H42O6SSi/c1-25-17-20-27(21-18-25)39(34,35)36-24-31-30(33)22-19-26(38-31)12-11-23-37-40(32(2,3)4,28-13-7-5-8-14-28)29-15-9-6-10-16-29/h5-10,13-18,20-21,26,30-31,33H,11-12,19,22-24H2,1-4H3/t26-,30+,31-/m1/s1 |
| InChIKey | KQVPUODPUWPVEU-SATCGAIXSA-N |
| XLogP | 4.97 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|