C29H36O5SSi — CID 10864313
[(2R,3R)-3-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10864313) has the molecular formula C29H36O5SSi and a molecular weight of 524.76 g/mol. Its IUPAC name is [(2R,3R)-3-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R)-3-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10864313 |
| Molecular Formula | C29H36O5SSi |
| Molecular Weight | 524.76 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | [(2R,3R)-3-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H]2C(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H36O5SSi/c1-22-16-18-24(19-17-22)35(30,31)32-21-27-28(34-27)23(2)20-33-36(29(3,4)5,25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-19,23,27-28H,20-21H2,1-5H3/t23?,27-,28-/m1/s1 |
| InChIKey | AVTQDHLKRXUWKQ-QSFNAEDHSA-N |
| XLogP | 4.68 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|