C29H36O6SSi — CID 171122000
[(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 171122000) has the molecular formula C29H36O6SSi and a molecular weight of 540.75 g/mol. Its IUPAC name is [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171122000 |
| Molecular Formula | C29H36O6SSi |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | [(2S,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-hydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H](O)O2)cc1 |
| InChI | InChI=1S/C29H36O6SSi/c1-22-15-17-25(18-16-22)36(31,32)33-21-24-19-23(20-28(30)34-24)35-37(29(2,3)4,26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-18,23-24,28,30H,19-21H2,1-4H3/t23-,24+,28-/m1/s1 |
| InChIKey | BQRUORGFOMIMNB-FMGHJNRGSA-N |
| XLogP | 4.14 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|