C13H18O7S — CID 171122517
[(2R,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 171122517) has the molecular formula C13H18O7S and a molecular weight of 318.35 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171122517 |
| Molecular Formula | C13H18O7S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [(2R,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H](O)C[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H18O7S/c1-8-2-4-9(5-3-8)21(17,18)19-7-11-13(16)10(14)6-12(15)20-11/h2-5,10-16H,6-7H2,1H3/t10-,11-,12-,13+/m1/s1 |
| InChIKey | AOHLLZLTZMGLTI-LPWJVIDDSA-N |
| XLogP | -0.47 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|