C21H34O7S — CID 71614744
[(2R,3S,4R,6S)-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 71614744) has the molecular formula C21H34O7S and a molecular weight of 430.56 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,6S)-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71614744 |
| Molecular Formula | C21H34O7S |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [(2R,3S,4R,6S)-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCCCCCCCO[C@@H]1C[C@@H](O)[C@H](O)[C@@H](COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C21H34O7S/c1-3-4-5-6-7-8-13-26-20-14-18(22)21(23)19(28-20)15-27-29(24,25)17-11-9-16(2)10-12-17/h9-12,18-23H,3-8,13-15H2,1-2H3/t18-,19-,20+,21+/m1/s1 |
| InChIKey | CFEHLRNNLZUPNA-CGXNFDGLSA-N |
| XLogP | 2.91 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|