C25H42O3S — CID 10916844
5-[(1R,2S)-2-decylcyclopropyl]pentyl 4-methylbenzenesulfonate (PubChem CID 10916844) has the molecular formula C25H42O3S and a molecular weight of 422.68 g/mol. Its IUPAC name is 5-[(1R,2S)-2-decylcyclopropyl]pentyl 4-methylbenzenesulfonate.
| Compound Name | 5-[(1R,2S)-2-decylcyclopropyl]pentyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10916844 |
| Molecular Formula | C25H42O3S |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 5-[(1R,2S)-2-decylcyclopropyl]pentyl 4-methylbenzenesulfonate |
| SMILES | CCCCCCCCCC[C@H]1C[C@H]1CCCCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H42O3S/c1-3-4-5-6-7-8-9-11-14-23-21-24(23)15-12-10-13-20-28-29(26,27)25-18-16-22(2)17-19-25/h16-19,23-24H,3-15,20-21H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | UNMUGJIWBQBCKY-BJKOFHAPSA-N |
| XLogP | 7.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|