C26H42O3S — CID 139947969
2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl 4-methylbenzenesulfonate (PubChem CID 139947969) has the molecular formula C26H42O3S and a molecular weight of 434.69 g/mol. Its IUPAC name is 2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139947969 |
| Molecular Formula | C26H42O3S |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl 4-methylbenzenesulfonate |
| SMILES | CCCCCC1CCC(C2CCC(CCOS(=O)(=O)c3ccc(C)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H42O3S/c1-3-4-5-6-22-9-13-24(14-10-22)25-15-11-23(12-16-25)19-20-29-30(27,28)26-17-7-21(2)8-18-26/h7-8,17-18,22-25H,3-6,9-16,19-20H2,1-2H3 |
| InChIKey | OWIKPFJNLUJTEU-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|