C23H36N2O6S — CID 158185948
2-(1-formylpiperidin-4-yl)ethyl 4-methylbenzenesulfonate;4-(2-hydroxyethyl)piperidine-1-carbaldehyde (PubChem CID 158185948) has the molecular formula C23H36N2O6S and a molecular weight of 468.62 g/mol. Its IUPAC name is 2-(1-formylpiperidin-4-yl)ethyl 4-methylbenzenesulfonate;4-(2-hydroxyethyl)piperidine-1-carbaldehyde.
| Compound Name | 2-(1-formylpiperidin-4-yl)ethyl 4-methylbenzenesulfonate;4-(2-hydroxyethyl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 158185948 |
| Molecular Formula | C23H36N2O6S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2-(1-formylpiperidin-4-yl)ethyl 4-methylbenzenesulfonate;4-(2-hydroxyethyl)piperidine-1-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2CCN(C=O)CC2)cc1.O=CN1CCC(CCO)CC1 |
| InChI | InChI=1S/C15H21NO4S.C8H15NO2/c1-13-2-4-15(5-3-13)21(18,19)20-11-8-14-6-9-16(12-17)10-7-14;10-6-3-8-1-4-9(7-11)5-2-8/h2-5,12,14H,6-11H2,1H3;7-8,10H,1-6H2 |
| InChIKey | FZDGBVWSEWGTAZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|