C19H31NO5S — CID 143429984
tert-butyl formate;(1-methylpiperidin-4-yl)methyl 4-methylbenzenesulfonate (PubChem CID 143429984) has the molecular formula C19H31NO5S and a molecular weight of 385.53 g/mol. Its IUPAC name is tert-butyl formate;(1-methylpiperidin-4-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | tert-butyl formate;(1-methylpiperidin-4-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 143429984 |
| Molecular Formula | C19H31NO5S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | tert-butyl formate;(1-methylpiperidin-4-yl)methyl 4-methylbenzenesulfonate |
| SMILES | CC(C)(C)OC=O.Cc1ccc(S(=O)(=O)OCC2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C14H21NO3S.C5H10O2/c1-12-3-5-14(6-4-12)19(16,17)18-11-13-7-9-15(2)10-8-13;1-5(2,3)7-4-6/h3-6,13H,7-11H2,1-2H3;4H,1-3H3 |
| InChIKey | RIVFXCRXJBTHBQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|