C15H22O3S — CID 135389568
(3,4-dimethylcyclopentyl)methyl 4-methylbenzenesulfonate (PubChem CID 135389568) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is (3,4-dimethylcyclopentyl)methyl 4-methylbenzenesulfonate.
| Compound Name | (3,4-dimethylcyclopentyl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135389568 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (3,4-dimethylcyclopentyl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(C)C(C)C2)cc1 |
| InChI | InChI=1S/C15H22O3S/c1-11-4-6-15(7-5-11)19(16,17)18-10-14-8-12(2)13(3)9-14/h4-7,12-14H,8-10H2,1-3H3 |
| InChIKey | AJGJYFOFQRGYPO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|