C14H20O5S — CID 14893699
(2,2-dimethyl-1,3-dioxan-5-yl)methyl 4-methylbenzenesulfonate (PubChem CID 14893699) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxan-5-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (2,2-dimethyl-1,3-dioxan-5-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14893699 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxan-5-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2COC(C)(C)OC2)cc1 |
| InChI | InChI=1S/C14H20O5S/c1-11-4-6-13(7-5-11)20(15,16)19-10-12-8-17-14(2,3)18-9-12/h4-7,12H,8-10H2,1-3H3 |
| InChIKey | PTLZUYYTWMVUEN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|