C16H24O5S — CID 12770866
4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butyl 4-methylbenzenesulfonate (PubChem CID 12770866) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butyl 4-methylbenzenesulfonate.
| Compound Name | 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12770866 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]butyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H24O5S/c1-13-7-9-15(10-8-13)22(17,18)20-11-5-4-6-14-12-19-16(2,3)21-14/h7-10,14H,4-6,11-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | MXJVPISVFNYWFD-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|