C21H28O6S — CID 90872270
3-[2-methyl-2-(5-oxohepta-2,6-dienyl)-1,3-dioxolan-4-yl]propyl 4-methylbenzenesulfonate (PubChem CID 90872270) has the molecular formula C21H28O6S and a molecular weight of 408.52 g/mol. Its IUPAC name is 3-[2-methyl-2-(5-oxohepta-2,6-dienyl)-1,3-dioxolan-4-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[2-methyl-2-(5-oxohepta-2,6-dienyl)-1,3-dioxolan-4-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90872270 |
| Molecular Formula | C21H28O6S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 3-[2-methyl-2-(5-oxohepta-2,6-dienyl)-1,3-dioxolan-4-yl]propyl 4-methylbenzenesulfonate |
| SMILES | C=CC(=O)CC=CCC1(C)OCC(CCCOS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C21H28O6S/c1-4-18(22)8-5-6-14-21(3)25-16-19(27-21)9-7-15-26-28(23,24)20-12-10-17(2)11-13-20/h4-6,10-13,19H,1,7-9,14-16H2,2-3H3 |
| InChIKey | BMYBKJAAUBOLCV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|