C30H42O10S2 — CID 10841654
[(3S,4S)-1,6-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(4-methylphenyl)sulfonyloxyhexan-3-yl] 4-methylbenzenesulfonate (PubChem CID 10841654) has the molecular formula C30H42O10S2 and a molecular weight of 626.79 g/mol. Its IUPAC name is [(3S,4S)-1,6-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(4-methylphenyl)sulfonyloxyhexan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,4S)-1,6-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(4-methylphenyl)sulfonyloxyhexan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10841654 |
| Molecular Formula | C30H42O10S2 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | [(3S,4S)-1,6-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(4-methylphenyl)sulfonyloxyhexan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](CC[C@@H]2COC(C)(C)O2)[C@H](CC[C@@H]2COC(C)(C)O2)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H42O10S2/c1-21-7-13-25(14-8-21)41(31,32)39-27(17-11-23-19-35-29(3,4)37-23)28(18-12-24-20-36-30(5,6)38-24)40-42(33,34)26-15-9-22(2)10-16-26/h7-10,13-16,23-24,27-28H,11-12,17-20H2,1-6H3/t23-,24-,27+,28+/m1/s1 |
| InChIKey | GJNFTRJTCQZTHY-ZBVBGGFBSA-N |
| XLogP | 5.01 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|