C16H18O8S — CID 118268443
[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-5-oxo-2H-furan-4-yl] 4-methylbenzenesulfonate (PubChem CID 118268443) has the molecular formula C16H18O8S and a molecular weight of 370.38 g/mol. Its IUPAC name is [2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-5-oxo-2H-furan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-5-oxo-2H-furan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118268443 |
| Molecular Formula | C16H18O8S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | [2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-5-oxo-2H-furan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2=C(O)C(C3COC(C)(C)O3)OC2=O)cc1 |
| InChI | InChI=1S/C16H18O8S/c1-9-4-6-10(7-5-9)25(19,20)24-14-12(17)13(22-15(14)18)11-8-21-16(2,3)23-11/h4-7,11,13,17H,8H2,1-3H3 |
| InChIKey | LRWPQYQAVHUYEK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|