C24H34O10S2 — CID 11060647
[(2S,5R,6R,9S)-1,2,9,10-tetrahydroxy-6-(4-methylphenyl)sulfonyloxydecan-5-yl] 4-methylbenzenesulfonate (PubChem CID 11060647) has the molecular formula C24H34O10S2 and a molecular weight of 546.66 g/mol. Its IUPAC name is [(2S,5R,6R,9S)-1,2,9,10-tetrahydroxy-6-(4-methylphenyl)sulfonyloxydecan-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,5R,6R,9S)-1,2,9,10-tetrahydroxy-6-(4-methylphenyl)sulfonyloxydecan-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11060647 |
| Molecular Formula | C24H34O10S2 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [(2S,5R,6R,9S)-1,2,9,10-tetrahydroxy-6-(4-methylphenyl)sulfonyloxydecan-5-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](CC[C@H](O)CO)[C@@H](CC[C@H](O)CO)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H34O10S2/c1-17-3-9-21(10-4-17)35(29,30)33-23(13-7-19(27)15-25)24(14-8-20(28)16-26)34-36(31,32)22-11-5-18(2)6-12-22/h3-6,9-12,19-20,23-28H,7-8,13-16H2,1-2H3/t19-,20-,23+,24+/m0/s1 |
| InChIKey | XTTNBYUROFEMNV-UWXQAFAOSA-N |
| XLogP | 1.42 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|