C20H26O10S2 — CID 98525545
[(2R,3S,4R,5S)-1,3,4,6-tetrahydroxy-5-(4-methylphenyl)sulfonyloxyhexan-2-yl] 4-methylbenzenesulfonate (PubChem CID 98525545) has the molecular formula C20H26O10S2 and a molecular weight of 490.55 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-1,3,4,6-tetrahydroxy-5-(4-methylphenyl)sulfonyloxyhexan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4R,5S)-1,3,4,6-tetrahydroxy-5-(4-methylphenyl)sulfonyloxyhexan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 98525545 |
| Molecular Formula | C20H26O10S2 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | [(2R,3S,4R,5S)-1,3,4,6-tetrahydroxy-5-(4-methylphenyl)sulfonyloxyhexan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](CO)[C@H](O)[C@H](O)[C@@H](CO)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H26O10S2/c1-13-3-7-15(8-4-13)31(25,26)29-17(11-21)19(23)20(24)18(12-22)30-32(27,28)16-9-5-14(2)6-10-16/h3-10,17-24H,11-12H2,1-2H3/t17-,18+,19-,20+ |
| InChIKey | QJCMJDSXUPHTGI-FGYAAKKASA-N |
| XLogP | -0.14 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|