C16H26O4S — CID 87937085
[4-(hydroxymethyl)-2,5-dimethylhexan-3-yl] 4-methylbenzenesulfonate (PubChem CID 87937085) has the molecular formula C16H26O4S and a molecular weight of 314.45 g/mol. Its IUPAC name is [4-(hydroxymethyl)-2,5-dimethylhexan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-(hydroxymethyl)-2,5-dimethylhexan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87937085 |
| Molecular Formula | C16H26O4S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [4-(hydroxymethyl)-2,5-dimethylhexan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C(C)C)C(CO)C(C)C)cc1 |
| InChI | InChI=1S/C16H26O4S/c1-11(2)15(10-17)16(12(3)4)20-21(18,19)14-8-6-13(5)7-9-14/h6-9,11-12,15-17H,10H2,1-5H3 |
| InChIKey | CNFCEXPFOMQNDA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|