C11H15O3SW- — CID 58505309
butan-2-yl 4-methylbenzenesulfonate;tungsten (PubChem CID 58505309) has the molecular formula C11H15O3SW- and a molecular weight of 411.15 g/mol. Its IUPAC name is butan-2-yl 4-methylbenzenesulfonate;tungsten.
| Compound Name | butan-2-yl 4-methylbenzenesulfonate;tungsten |
|---|---|
| PubChem CID | 58505309 |
| Molecular Formula | C11H15O3SW- |
| Molecular Weight | 411.15 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | butan-2-yl 4-methylbenzenesulfonate;tungsten |
| SMILES | [CH2-]CC(C)OS(=O)(=O)c1ccc(C)cc1.[W] |
| InChI | InChI=1S/C11H15O3S.W/c1-4-10(3)14-15(12,13)11-7-5-9(2)6-8-11;/h5-8,10H,1,4H2,2-3H3;/q-1; |
| InChIKey | WXOIXKGBMIBWIV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|