C14H22O4S — CID 59861105
[(2R)-1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 4-methylbenzenesulfonate (PubChem CID 59861105) has the molecular formula C14H22O4S and a molecular weight of 286.39 g/mol. Its IUPAC name is [(2R)-1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59861105 |
| Molecular Formula | C14H22O4S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [(2R)-1-[(2-methylpropan-2-yl)oxy]propan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](C)COC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H22O4S/c1-11-6-8-13(9-7-11)19(15,16)18-12(2)10-17-14(3,4)5/h6-9,12H,10H2,1-5H3/t12-/m1/s1 |
| InChIKey | SRCSIPXDHCQQGS-GFCCVEGCSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|