C16H28O4SSi — CID 173064331
(4,5,5-trimethyl-4-silyloxyhexan-2-yl) 4-methylbenzenesulfonate (PubChem CID 173064331) has the molecular formula C16H28O4SSi and a molecular weight of 344.55 g/mol. Its IUPAC name is (4,5,5-trimethyl-4-silyloxyhexan-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (4,5,5-trimethyl-4-silyloxyhexan-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173064331 |
| Molecular Formula | C16H28O4SSi |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (4,5,5-trimethyl-4-silyloxyhexan-2-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)CC(C)(O[SiH3])C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H28O4SSi/c1-12-7-9-14(10-8-12)21(17,18)19-13(2)11-16(6,20-22)15(3,4)5/h7-10,13H,11H2,1-6,22H3 |
| InChIKey | PGSHIWYJBXAUTN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|