C17H28O3S — CID 21485207
4,6,6-trimethylheptan-2-yl 4-methylbenzenesulfonate (PubChem CID 21485207) has the molecular formula C17H28O3S and a molecular weight of 312.48 g/mol. Its IUPAC name is 4,6,6-trimethylheptan-2-yl 4-methylbenzenesulfonate.
| Compound Name | 4,6,6-trimethylheptan-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 21485207 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4,6,6-trimethylheptan-2-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)CC(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28O3S/c1-13-7-9-16(10-8-13)21(18,19)20-15(3)11-14(2)12-17(4,5)6/h7-10,14-15H,11-12H2,1-6H3 |
| InChIKey | NWEFKJCUYBFVIS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|