C15H22O3S — CID 13213644
6-methylhept-5-en-2-yl 4-methylbenzenesulfonate (PubChem CID 13213644) has the molecular formula C15H22O3S and a molecular weight of 282.41 g/mol. Its IUPAC name is 6-methylhept-5-en-2-yl 4-methylbenzenesulfonate.
| Compound Name | 6-methylhept-5-en-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13213644 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 6-methylhept-5-en-2-yl 4-methylbenzenesulfonate |
| SMILES | CC(C)=CCCC(C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22O3S/c1-12(2)6-5-7-14(4)18-19(16,17)15-10-8-13(3)9-11-15/h6,8-11,14H,5,7H2,1-4H3 |
| InChIKey | YQUVVXHOSZUKBR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|